C29H41NO6S — CID 67583732
4-butyl-3-[3-(2-methoxy-4-propan-2-ylsulfonylphenyl)octanoylamino]benzoic acid (PubChem CID 67583732) has the molecular formula C29H41NO6S and a molecular weight of 531.72 g/mol. Its IUPAC name is 4-butyl-3-[3-(2-methoxy-4-propan-2-ylsulfonylphenyl)octanoylamino]benzoic acid.
| Compound Name | 4-butyl-3-[3-(2-methoxy-4-propan-2-ylsulfonylphenyl)octanoylamino]benzoic acid |
|---|---|
| PubChem CID | 67583732 |
| Molecular Formula | C29H41NO6S |
| Molecular Weight | 531.72 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | 4-butyl-3-[3-(2-methoxy-4-propan-2-ylsulfonylphenyl)octanoylamino]benzoic acid |
| SMILES | CCCCCC(CC(=O)Nc1cc(C(=O)O)ccc1CCCC)c1ccc(S(=O)(=O)C(C)C)cc1OC |
| InChI | InChI=1S/C29H41NO6S/c1-6-8-10-12-22(25-16-15-24(19-27(25)36-5)37(34,35)20(3)4)18-28(31)30-26-17-23(29(32)33)14-13-21(26)11-9-7-2/h13-17,19-20,22H,6-12,18H2,1-5H3,(H,30,31)(H,32,33) |
| InChIKey | YNBHPFDIUXUCLJ-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.72 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|