C29H41NO6 — CID 139784333
methyl 4-tert-butyl-3-[3-(2,3,4-trimethoxyphenyl)octanoylamino]benzoate (PubChem CID 139784333) has the molecular formula C29H41NO6 and a molecular weight of 499.65 g/mol. Its IUPAC name is methyl 4-tert-butyl-3-[3-(2,3,4-trimethoxyphenyl)octanoylamino]benzoate.
| Compound Name | methyl 4-tert-butyl-3-[3-(2,3,4-trimethoxyphenyl)octanoylamino]benzoate |
|---|---|
| PubChem CID | 139784333 |
| Molecular Formula | C29H41NO6 |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | methyl 4-tert-butyl-3-[3-(2,3,4-trimethoxyphenyl)octanoylamino]benzoate |
| SMILES | CCCCCC(CC(=O)Nc1cc(C(=O)OC)ccc1C(C)(C)C)c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C29H41NO6/c1-9-10-11-12-19(21-14-16-24(33-5)27(35-7)26(21)34-6)18-25(31)30-23-17-20(28(32)36-8)13-15-22(23)29(2,3)4/h13-17,19H,9-12,18H2,1-8H3,(H,30,31) |
| InChIKey | GWYRDYINCJRVOJ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|