C34H49NO8 — CID 139706416
4-[3-[4-tert-butyl-3-[3-(2,3,4-trimethoxyphenyl)octanoylamino]phenyl]propoxy]-4-oxobutanoic acid (PubChem CID 139706416) has the molecular formula C34H49NO8 and a molecular weight of 599.77 g/mol. Its IUPAC name is 4-[3-[4-tert-butyl-3-[3-(2,3,4-trimethoxyphenyl)octanoylamino]phenyl]propoxy]-4-oxobutanoic acid.
| Compound Name | 4-[3-[4-tert-butyl-3-[3-(2,3,4-trimethoxyphenyl)octanoylamino]phenyl]propoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 139706416 |
| Molecular Formula | C34H49NO8 |
| Molecular Weight | 599.77 g/mol |
| Exact Mass | 599.35 |
| IUPAC Name | 4-[3-[4-tert-butyl-3-[3-(2,3,4-trimethoxyphenyl)octanoylamino]phenyl]propoxy]-4-oxobutanoic acid |
| SMILES | CCCCCC(CC(=O)Nc1cc(CCCOC(=O)CCC(=O)O)ccc1C(C)(C)C)c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C34H49NO8/c1-8-9-10-13-24(25-15-17-28(40-5)33(42-7)32(25)41-6)22-29(36)35-27-21-23(14-16-26(27)34(2,3)4)12-11-20-43-31(39)19-18-30(37)38/h14-17,21,24H,8-13,18-20,22H2,1-7H3,(H,35,36)(H,37,38) |
| InChIKey | UGOCUICQKXJYQU-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.77 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|