C31H46N2O5 — CID 19348484
N-[2-tert-butyl-5-[3-(methylamino)-3-oxopropyl]phenyl]-3-(2,4,5-trimethoxyphenyl)octanamide (PubChem CID 19348484) has the molecular formula C31H46N2O5 and a molecular weight of 526.72 g/mol. Its IUPAC name is N-[2-tert-butyl-5-[3-(methylamino)-3-oxopropyl]phenyl]-3-(2,4,5-trimethoxyphenyl)octanamide.
| Compound Name | N-[2-tert-butyl-5-[3-(methylamino)-3-oxopropyl]phenyl]-3-(2,4,5-trimethoxyphenyl)octanamide |
|---|---|
| PubChem CID | 19348484 |
| Molecular Formula | C31H46N2O5 |
| Molecular Weight | 526.72 g/mol |
| Exact Mass | 526.34 |
| IUPAC Name | N-[2-tert-butyl-5-[3-(methylamino)-3-oxopropyl]phenyl]-3-(2,4,5-trimethoxyphenyl)octanamide |
| SMILES | CCCCCC(CC(=O)Nc1cc(CCC(=O)NC)ccc1C(C)(C)C)c1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C31H46N2O5/c1-9-10-11-12-22(23-19-27(37-7)28(38-8)20-26(23)36-6)18-30(35)33-25-17-21(14-16-29(34)32-5)13-15-24(25)31(2,3)4/h13,15,17,19-20,22H,9-12,14,16,18H2,1-8H3,(H,32,34)(H,33,35) |
| InChIKey | BODFEIVZEOLZRW-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.72 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|