C30H44N2O5 — CID 19348430
N-[5-(acetamidomethyl)-2-tert-butylphenyl]-3-(2,4,6-trimethoxyphenyl)octanamide (PubChem CID 19348430) has the molecular formula C30H44N2O5 and a molecular weight of 512.69 g/mol. Its IUPAC name is N-[5-(acetamidomethyl)-2-tert-butylphenyl]-3-(2,4,6-trimethoxyphenyl)octanamide.
| Compound Name | N-[5-(acetamidomethyl)-2-tert-butylphenyl]-3-(2,4,6-trimethoxyphenyl)octanamide |
|---|---|
| PubChem CID | 19348430 |
| Molecular Formula | C30H44N2O5 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.33 |
| IUPAC Name | N-[5-(acetamidomethyl)-2-tert-butylphenyl]-3-(2,4,6-trimethoxyphenyl)octanamide |
| SMILES | CCCCCC(CC(=O)Nc1cc(CNC(C)=O)ccc1C(C)(C)C)c1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C30H44N2O5/c1-9-10-11-12-22(29-26(36-7)17-23(35-6)18-27(29)37-8)16-28(34)32-25-15-21(19-31-20(2)33)13-14-24(25)30(3,4)5/h13-15,17-18,22H,9-12,16,19H2,1-8H3,(H,31,33)(H,32,34) |
| InChIKey | ZEQJRJMXMFSNEJ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|