C34H45N3O5 — CID 70284190
N-[[4-tert-butyl-3-[3-(2,4,5-trimethoxyphenyl)octanoylamino]phenyl]methyl]pyridine-3-carboxamide (PubChem CID 70284190) has the molecular formula C34H45N3O5 and a molecular weight of 575.75 g/mol. Its IUPAC name is N-[[4-tert-butyl-3-[3-(2,4,5-trimethoxyphenyl)octanoylamino]phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | N-[[4-tert-butyl-3-[3-(2,4,5-trimethoxyphenyl)octanoylamino]phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 70284190 |
| Molecular Formula | C34H45N3O5 |
| Molecular Weight | 575.75 g/mol |
| Exact Mass | 575.34 |
| IUPAC Name | N-[[4-tert-butyl-3-[3-(2,4,5-trimethoxyphenyl)octanoylamino]phenyl]methyl]pyridine-3-carboxamide |
| SMILES | CCCCCC(CC(=O)Nc1cc(CNC(=O)c2cccnc2)ccc1C(C)(C)C)c1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C34H45N3O5/c1-8-9-10-12-24(26-19-30(41-6)31(42-7)20-29(26)40-5)18-32(38)37-28-17-23(14-15-27(28)34(2,3)4)21-36-33(39)25-13-11-16-35-22-25/h11,13-17,19-20,22,24H,8-10,12,18,21H2,1-7H3,(H,36,39)(H,37,38) |
| InChIKey | IKTBGYFCJHWIMV-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.75 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|