C34H45NO4 — CID 139706379
N-[2-tert-butyl-5-(1-hydroxyethyl)phenyl]-3-(3-methoxy-2-phenylmethoxyphenyl)octanamide (PubChem CID 139706379) has the molecular formula C34H45NO4 and a molecular weight of 531.74 g/mol. Its IUPAC name is N-[2-tert-butyl-5-(1-hydroxyethyl)phenyl]-3-(3-methoxy-2-phenylmethoxyphenyl)octanamide.
| Compound Name | N-[2-tert-butyl-5-(1-hydroxyethyl)phenyl]-3-(3-methoxy-2-phenylmethoxyphenyl)octanamide |
|---|---|
| PubChem CID | 139706379 |
| Molecular Formula | C34H45NO4 |
| Molecular Weight | 531.74 g/mol |
| Exact Mass | 531.33 |
| IUPAC Name | N-[2-tert-butyl-5-(1-hydroxyethyl)phenyl]-3-(3-methoxy-2-phenylmethoxyphenyl)octanamide |
| SMILES | CCCCCC(CC(=O)Nc1cc(C(C)O)ccc1C(C)(C)C)c1cccc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C34H45NO4/c1-7-8-10-16-27(22-32(37)35-30-21-26(24(2)36)19-20-29(30)34(3,4)5)28-17-13-18-31(38-6)33(28)39-23-25-14-11-9-12-15-25/h9,11-15,17-21,24,27,36H,7-8,10,16,22-23H2,1-6H3,(H,35,37) |
| InChIKey | BSOPUEFOCKPHIR-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.74 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|