C33H43NO4 — CID 139706319
N-[2-tert-butyl-5-(hydroxymethyl)phenyl]-3-(3-methoxy-2-phenylmethoxyphenyl)octanamide (PubChem CID 139706319) has the molecular formula C33H43NO4 and a molecular weight of 517.71 g/mol. Its IUPAC name is N-[2-tert-butyl-5-(hydroxymethyl)phenyl]-3-(3-methoxy-2-phenylmethoxyphenyl)octanamide.
| Compound Name | N-[2-tert-butyl-5-(hydroxymethyl)phenyl]-3-(3-methoxy-2-phenylmethoxyphenyl)octanamide |
|---|---|
| PubChem CID | 139706319 |
| Molecular Formula | C33H43NO4 |
| Molecular Weight | 517.71 g/mol |
| Exact Mass | 517.32 |
| IUPAC Name | N-[2-tert-butyl-5-(hydroxymethyl)phenyl]-3-(3-methoxy-2-phenylmethoxyphenyl)octanamide |
| SMILES | CCCCCC(CC(=O)Nc1cc(CO)ccc1C(C)(C)C)c1cccc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C33H43NO4/c1-6-7-9-15-26(21-31(36)34-29-20-25(22-35)18-19-28(29)33(2,3)4)27-16-12-17-30(37-5)32(27)38-23-24-13-10-8-11-14-24/h8,10-14,16-20,26,35H,6-7,9,15,21-23H2,1-5H3,(H,34,36) |
| InChIKey | SKSLUDOQMVJFRP-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.71 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|