C30H44N2O3 — CID 139734028
N-[2-tert-butyl-5-(morpholin-4-ylmethyl)phenyl]-3-(2-methoxyphenyl)octanamide (PubChem CID 139734028) has the molecular formula C30H44N2O3 and a molecular weight of 480.69 g/mol. Its IUPAC name is N-[2-tert-butyl-5-(morpholin-4-ylmethyl)phenyl]-3-(2-methoxyphenyl)octanamide.
| Compound Name | N-[2-tert-butyl-5-(morpholin-4-ylmethyl)phenyl]-3-(2-methoxyphenyl)octanamide |
|---|---|
| PubChem CID | 139734028 |
| Molecular Formula | C30H44N2O3 |
| Molecular Weight | 480.69 g/mol |
| Exact Mass | 480.34 |
| IUPAC Name | N-[2-tert-butyl-5-(morpholin-4-ylmethyl)phenyl]-3-(2-methoxyphenyl)octanamide |
| SMILES | CCCCCC(CC(=O)Nc1cc(CN2CCOCC2)ccc1C(C)(C)C)c1ccccc1OC |
| InChI | InChI=1S/C30H44N2O3/c1-6-7-8-11-24(25-12-9-10-13-28(25)34-5)21-29(33)31-27-20-23(14-15-26(27)30(2,3)4)22-32-16-18-35-19-17-32/h9-10,12-15,20,24H,6-8,11,16-19,21-22H2,1-5H3,(H,31,33) |
| InChIKey | DHTNBCOLDZMWLA-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.69 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|