C27H37NO4 — CID 139684161
3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-(2-hydroxyethyl)phenyl]octanamide (PubChem CID 139684161) has the molecular formula C27H37NO4 and a molecular weight of 439.60 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-(2-hydroxyethyl)phenyl]octanamide.
| Compound Name | 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-(2-hydroxyethyl)phenyl]octanamide |
|---|---|
| PubChem CID | 139684161 |
| Molecular Formula | C27H37NO4 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-(2-hydroxyethyl)phenyl]octanamide |
| SMILES | CCCCCC(CC(=O)Nc1cc(CCO)ccc1C(C)(C)C)c1cccc2c1OCO2 |
| InChI | InChI=1S/C27H37NO4/c1-5-6-7-9-20(21-10-8-11-24-26(21)32-18-31-24)17-25(30)28-23-16-19(14-15-29)12-13-22(23)27(2,3)4/h8,10-13,16,20,29H,5-7,9,14-15,17-18H2,1-4H3,(H,28,30) |
| InChIKey | LPBZHGWRCSVLLM-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|