C28H39NO4 — CID 139706326
3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-(3-hydroxypropyl)phenyl]octanamide (PubChem CID 139706326) has the molecular formula C28H39NO4 and a molecular weight of 453.62 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-(3-hydroxypropyl)phenyl]octanamide.
| Compound Name | 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-(3-hydroxypropyl)phenyl]octanamide |
|---|---|
| PubChem CID | 139706326 |
| Molecular Formula | C28H39NO4 |
| Molecular Weight | 453.62 g/mol |
| Exact Mass | 453.29 |
| IUPAC Name | 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-(3-hydroxypropyl)phenyl]octanamide |
| SMILES | CCCCCC(CC(=O)Nc1cc(CCCO)ccc1C(C)(C)C)c1cccc2c1OCO2 |
| InChI | InChI=1S/C28H39NO4/c1-5-6-7-11-21(22-12-8-13-25-27(22)33-19-32-25)18-26(31)29-24-17-20(10-9-16-30)14-15-23(24)28(2,3)4/h8,12-15,17,21,30H,5-7,9-11,16,18-19H2,1-4H3,(H,29,31) |
| InChIKey | TUMUUKZVCBGWDU-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.62 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|