C32H42NNaO7 — CID 139706263
sodium 3-(1,3-benzodioxol-4-yl)octanoyl-[2-tert-butyl-5-[3-(3-carboxypropanoyloxy)propyl]phenyl]azanide (PubChem CID 139706263) has the molecular formula C32H42NNaO7 and a molecular weight of 575.68 g/mol. Its IUPAC name is sodium 3-(1,3-benzodioxol-4-yl)octanoyl-[2-tert-butyl-5-[3-(3-carboxypropanoyloxy)propyl]phenyl]azanide.
| Compound Name | sodium 3-(1,3-benzodioxol-4-yl)octanoyl-[2-tert-butyl-5-[3-(3-carboxypropanoyloxy)propyl]phenyl]azanide |
|---|---|
| PubChem CID | 139706263 |
| Molecular Formula | C32H42NNaO7 |
| Molecular Weight | 575.68 g/mol |
| Exact Mass | 575.29 |
| IUPAC Name | sodium 3-(1,3-benzodioxol-4-yl)octanoyl-[2-tert-butyl-5-[3-(3-carboxypropanoyloxy)propyl]phenyl]azanide |
| SMILES | CCCCCC(CC(=O)[N-]c1cc(CCCOC(=O)CCC(=O)O)ccc1C(C)(C)C)c1cccc2c1OCO2.[Na+] |
| InChI | InChI=1S/C32H43NO7.Na/c1-5-6-7-11-23(24-12-8-13-27-31(24)40-21-39-27)20-28(34)33-26-19-22(14-15-25(26)32(2,3)4)10-9-18-38-30(37)17-16-29(35)36;/h8,12-15,19,23H,5-7,9-11,16-18,20-21H2,1-4H3,(H2,33,34,35,36);/q;+1/p-1 |
| InChIKey | DVSSWKXMOWSALF-UHFFFAOYSA-M |
| XLogP | 4.34 |
| TPSA | 113.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.68 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|