C23H33N5O4 — CID 54373433
1-[(2R)-2-(1,3-benzodioxol-4-yl)heptyl]-3-[4-(dimethylamino)-6-ethoxypyrimidin-5-yl]urea (PubChem CID 54373433) has the molecular formula C23H33N5O4 and a molecular weight of 443.55 g/mol. Its IUPAC name is 1-[(2R)-2-(1,3-benzodioxol-4-yl)heptyl]-3-[4-(dimethylamino)-6-ethoxypyrimidin-5-yl]urea.
| Compound Name | 1-[(2R)-2-(1,3-benzodioxol-4-yl)heptyl]-3-[4-(dimethylamino)-6-ethoxypyrimidin-5-yl]urea |
|---|---|
| PubChem CID | 54373433 |
| Molecular Formula | C23H33N5O4 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | 1-[(2R)-2-(1,3-benzodioxol-4-yl)heptyl]-3-[4-(dimethylamino)-6-ethoxypyrimidin-5-yl]urea |
| SMILES | CCCCCC(CNC(=O)Nc1c(OCC)ncnc1N(C)C)c1cccc2c1OCO2 |
| InChI | InChI=1S/C23H33N5O4/c1-5-7-8-10-16(17-11-9-12-18-20(17)32-15-31-18)13-24-23(29)27-19-21(28(3)4)25-14-26-22(19)30-6-2/h9,11-12,14,16H,5-8,10,13,15H2,1-4H3,(H2,24,27,29) |
| InChIKey | UUVAENAYRWBMDB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|