C34H53NO4Si — CID 139706274
3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]octanamide (PubChem CID 139706274) has the molecular formula C34H53NO4Si and a molecular weight of 567.89 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]octanamide.
| Compound Name | 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]octanamide |
|---|---|
| PubChem CID | 139706274 |
| Molecular Formula | C34H53NO4Si |
| Molecular Weight | 567.89 g/mol |
| Exact Mass | 567.37 |
| IUPAC Name | 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]octanamide |
| SMILES | CCCCCC(CC(=O)Nc1cc(CCCO[Si](C)(C)C(C)(C)C)ccc1C(C)(C)C)c1cccc2c1OCO2 |
| InChI | InChI=1S/C34H53NO4Si/c1-10-11-12-16-26(27-17-13-18-30-32(27)38-24-37-30)23-31(36)35-29-22-25(19-20-28(29)33(2,3)4)15-14-21-39-40(8,9)34(5,6)7/h13,17-20,22,26H,10-12,14-16,21,23-24H2,1-9H3,(H,35,36) |
| InChIKey | GSDMCYBRFOWQMX-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.89 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|