C27H37NO3 — CID 54260913
(3R)-3-(1,3-benzodioxol-4-yl)-N-[2,6-di(propan-2-yl)phenyl]octanamide (PubChem CID 54260913) has the molecular formula C27H37NO3 and a molecular weight of 423.60 g/mol. Its IUPAC name is (3R)-3-(1,3-benzodioxol-4-yl)-N-[2,6-di(propan-2-yl)phenyl]octanamide.
| Compound Name | (3R)-3-(1,3-benzodioxol-4-yl)-N-[2,6-di(propan-2-yl)phenyl]octanamide |
|---|---|
| PubChem CID | 54260913 |
| Molecular Formula | C27H37NO3 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | (3R)-3-(1,3-benzodioxol-4-yl)-N-[2,6-di(propan-2-yl)phenyl]octanamide |
| SMILES | CCCCC[C@H](CC(=O)Nc1c(C(C)C)cccc1C(C)C)c1cccc2c1OCO2 |
| InChI | InChI=1S/C27H37NO3/c1-6-7-8-11-20(23-14-10-15-24-27(23)31-17-30-24)16-25(29)28-26-21(18(2)3)12-9-13-22(26)19(4)5/h9-10,12-15,18-20H,6-8,11,16-17H2,1-5H3,(H,28,29)/t20-/m1/s1 |
| InChIKey | RDLCGPCKSBMVBT-HXUWFJFHSA-N |
| XLogP | 7.35 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|