C30H43NO4 — CID 139706244
3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-(5-hydroxypentyl)phenyl]octanamide (PubChem CID 139706244) has the molecular formula C30H43NO4 and a molecular weight of 481.68 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-(5-hydroxypentyl)phenyl]octanamide.
| Compound Name | 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-(5-hydroxypentyl)phenyl]octanamide |
|---|---|
| PubChem CID | 139706244 |
| Molecular Formula | C30H43NO4 |
| Molecular Weight | 481.68 g/mol |
| Exact Mass | 481.32 |
| IUPAC Name | 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-(5-hydroxypentyl)phenyl]octanamide |
| SMILES | CCCCCC(CC(=O)Nc1cc(CCCCCO)ccc1C(C)(C)C)c1cccc2c1OCO2 |
| InChI | InChI=1S/C30H43NO4/c1-5-6-8-13-23(24-14-11-15-27-29(24)35-21-34-27)20-28(33)31-26-19-22(12-9-7-10-18-32)16-17-25(26)30(2,3)4/h11,14-17,19,23,32H,5-10,12-13,18,20-21H2,1-4H3,(H,31,33) |
| InChIKey | VCXVOSJGCFCOTL-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.68 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|