C30H45NO5 — CID 139684178
N-[2-tert-butyl-5-(3-hydroxypropyl)phenyl]-3-(2,3,4-trimethoxyphenyl)octanamide (PubChem CID 139684178) has the molecular formula C30H45NO5 and a molecular weight of 499.69 g/mol. Its IUPAC name is N-[2-tert-butyl-5-(3-hydroxypropyl)phenyl]-3-(2,3,4-trimethoxyphenyl)octanamide.
| Compound Name | N-[2-tert-butyl-5-(3-hydroxypropyl)phenyl]-3-(2,3,4-trimethoxyphenyl)octanamide |
|---|---|
| PubChem CID | 139684178 |
| Molecular Formula | C30H45NO5 |
| Molecular Weight | 499.69 g/mol |
| Exact Mass | 499.33 |
| IUPAC Name | N-[2-tert-butyl-5-(3-hydroxypropyl)phenyl]-3-(2,3,4-trimethoxyphenyl)octanamide |
| SMILES | CCCCCC(CC(=O)Nc1cc(CCCO)ccc1C(C)(C)C)c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C30H45NO5/c1-8-9-10-13-22(23-15-17-26(34-5)29(36-7)28(23)35-6)20-27(33)31-25-19-21(12-11-18-32)14-16-24(25)30(2,3)4/h14-17,19,22,32H,8-13,18,20H2,1-7H3,(H,31,33) |
| InChIKey | OVTWNLTUVGKYJH-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.69 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|