C30H46N2O6S2 — CID 139784469
N-[2-tert-butyl-5-(sulfamoylmethyl)phenyl]-3-[2-methoxy-4-(2-methylpropylsulfonyl)phenyl]octanamide (PubChem CID 139784469) has the molecular formula C30H46N2O6S2 and a molecular weight of 594.84 g/mol. Its IUPAC name is N-[2-tert-butyl-5-(sulfamoylmethyl)phenyl]-3-[2-methoxy-4-(2-methylpropylsulfonyl)phenyl]octanamide.
| Compound Name | N-[2-tert-butyl-5-(sulfamoylmethyl)phenyl]-3-[2-methoxy-4-(2-methylpropylsulfonyl)phenyl]octanamide |
|---|---|
| PubChem CID | 139784469 |
| Molecular Formula | C30H46N2O6S2 |
| Molecular Weight | 594.84 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | N-[2-tert-butyl-5-(sulfamoylmethyl)phenyl]-3-[2-methoxy-4-(2-methylpropylsulfonyl)phenyl]octanamide |
| SMILES | CCCCCC(CC(=O)Nc1cc(CS(N)(=O)=O)ccc1C(C)(C)C)c1ccc(S(=O)(=O)CC(C)C)cc1OC |
| InChI | InChI=1S/C30H46N2O6S2/c1-8-9-10-11-23(25-14-13-24(18-28(25)38-7)39(34,35)19-21(2)3)17-29(33)32-27-16-22(20-40(31,36)37)12-15-26(27)30(4,5)6/h12-16,18,21,23H,8-11,17,19-20H2,1-7H3,(H,32,33)(H2,31,36,37) |
| InChIKey | AVVJKLNHLNYGEW-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 132.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.84 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|