C27H35N3O3 — CID 19348745
4-tert-butyl-3-[3-(4-cyano-2-methoxyphenyl)octanoylamino]benzamide (PubChem CID 19348745) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is 4-tert-butyl-3-[3-(4-cyano-2-methoxyphenyl)octanoylamino]benzamide.
| Compound Name | 4-tert-butyl-3-[3-(4-cyano-2-methoxyphenyl)octanoylamino]benzamide |
|---|---|
| PubChem CID | 19348745 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | 4-tert-butyl-3-[3-(4-cyano-2-methoxyphenyl)octanoylamino]benzamide |
| SMILES | CCCCCC(CC(=O)Nc1cc(C(N)=O)ccc1C(C)(C)C)c1ccc(C#N)cc1OC |
| InChI | InChI=1S/C27H35N3O3/c1-6-7-8-9-19(21-12-10-18(17-28)14-24(21)33-5)16-25(31)30-23-15-20(26(29)32)11-13-22(23)27(2,3)4/h10-15,19H,6-9,16H2,1-5H3,(H2,29,32)(H,30,31) |
| InChIKey | JOQWZZWRMDFKJF-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|