C27H37ClN2O4 — CID 19348673
4-tert-butyl-3-[3-(5-chloro-2,4-dimethoxyphenyl)octanoylamino]benzamide (PubChem CID 19348673) has the molecular formula C27H37ClN2O4 and a molecular weight of 489.06 g/mol. Its IUPAC name is 4-tert-butyl-3-[3-(5-chloro-2,4-dimethoxyphenyl)octanoylamino]benzamide.
| Compound Name | 4-tert-butyl-3-[3-(5-chloro-2,4-dimethoxyphenyl)octanoylamino]benzamide |
|---|---|
| PubChem CID | 19348673 |
| Molecular Formula | C27H37ClN2O4 |
| Molecular Weight | 489.06 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | 4-tert-butyl-3-[3-(5-chloro-2,4-dimethoxyphenyl)octanoylamino]benzamide |
| SMILES | CCCCCC(CC(=O)Nc1cc(C(N)=O)ccc1C(C)(C)C)c1cc(Cl)c(OC)cc1OC |
| InChI | InChI=1S/C27H37ClN2O4/c1-7-8-9-10-17(19-15-21(28)24(34-6)16-23(19)33-5)14-25(31)30-22-13-18(26(29)32)11-12-20(22)27(2,3)4/h11-13,15-17H,7-10,14H2,1-6H3,(H2,29,32)(H,30,31) |
| InChIKey | IYNNNYFZTLFQJV-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.06 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|