C29H40ClNO6 — CID 19348654
4-tert-butyl-3-[3-[5-chloro-2-methoxy-4-(3-methoxypropoxy)phenyl]heptanoylamino]benzoic acid (PubChem CID 19348654) has the molecular formula C29H40ClNO6 and a molecular weight of 534.09 g/mol. Its IUPAC name is 4-tert-butyl-3-[3-[5-chloro-2-methoxy-4-(3-methoxypropoxy)phenyl]heptanoylamino]benzoic acid.
| Compound Name | 4-tert-butyl-3-[3-[5-chloro-2-methoxy-4-(3-methoxypropoxy)phenyl]heptanoylamino]benzoic acid |
|---|---|
| PubChem CID | 19348654 |
| Molecular Formula | C29H40ClNO6 |
| Molecular Weight | 534.09 g/mol |
| Exact Mass | 533.25 |
| IUPAC Name | 4-tert-butyl-3-[3-[5-chloro-2-methoxy-4-(3-methoxypropoxy)phenyl]heptanoylamino]benzoic acid |
| SMILES | CCCCC(CC(=O)Nc1cc(C(=O)O)ccc1C(C)(C)C)c1cc(Cl)c(OCCCOC)cc1OC |
| InChI | InChI=1S/C29H40ClNO6/c1-7-8-10-19(21-17-23(30)26(18-25(21)36-6)37-14-9-13-35-5)16-27(32)31-24-15-20(28(33)34)11-12-22(24)29(2,3)4/h11-12,15,17-19H,7-10,13-14,16H2,1-6H3,(H,31,32)(H,33,34) |
| InChIKey | RGJQYYGIDUDHCJ-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.09 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|