C25H35NO4S — CID 70284589
4-tert-butyl-3-[3-(2-methoxy-4-methylthiophen-3-yl)octanoylamino]benzoic acid (PubChem CID 70284589) has the molecular formula C25H35NO4S and a molecular weight of 445.63 g/mol. Its IUPAC name is 4-tert-butyl-3-[3-(2-methoxy-4-methylthiophen-3-yl)octanoylamino]benzoic acid.
| Compound Name | 4-tert-butyl-3-[3-(2-methoxy-4-methylthiophen-3-yl)octanoylamino]benzoic acid |
|---|---|
| PubChem CID | 70284589 |
| Molecular Formula | C25H35NO4S |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 4-tert-butyl-3-[3-(2-methoxy-4-methylthiophen-3-yl)octanoylamino]benzoic acid |
| SMILES | CCCCCC(CC(=O)Nc1cc(C(=O)O)ccc1C(C)(C)C)c1c(C)csc1OC |
| InChI | InChI=1S/C25H35NO4S/c1-7-8-9-10-17(22-16(2)15-31-24(22)30-6)14-21(27)26-20-13-18(23(28)29)11-12-19(20)25(3,4)5/h11-13,15,17H,7-10,14H2,1-6H3,(H,26,27)(H,28,29) |
| InChIKey | XZDZNEUBOMYAFH-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|