C32H41N3O4 — CID 19348741
4-tert-butyl-3-[3-(2,6-dimethoxyphenyl)octanoylamino]-N-pyridin-4-ylbenzamide (PubChem CID 19348741) has the molecular formula C32H41N3O4 and a molecular weight of 531.70 g/mol. Its IUPAC name is 4-tert-butyl-3-[3-(2,6-dimethoxyphenyl)octanoylamino]-N-pyridin-4-ylbenzamide.
| Compound Name | 4-tert-butyl-3-[3-(2,6-dimethoxyphenyl)octanoylamino]-N-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 19348741 |
| Molecular Formula | C32H41N3O4 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.31 |
| IUPAC Name | 4-tert-butyl-3-[3-(2,6-dimethoxyphenyl)octanoylamino]-N-pyridin-4-ylbenzamide |
| SMILES | CCCCCC(CC(=O)Nc1cc(C(=O)Nc2ccncc2)ccc1C(C)(C)C)c1c(OC)cccc1OC |
| InChI | InChI=1S/C32H41N3O4/c1-7-8-9-11-22(30-27(38-5)12-10-13-28(30)39-6)21-29(36)35-26-20-23(14-15-25(26)32(2,3)4)31(37)34-24-16-18-33-19-17-24/h10,12-20,22H,7-9,11,21H2,1-6H3,(H,35,36)(H,33,34,37) |
| InChIKey | WADCNHGEBVXXMI-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|