C29H41N3O5 — CID 70284419
5-[1-[2-tert-butyl-5-(methylcarbamoyl)anilino]-1-oxooctan-3-yl]-2,4-dimethoxybenzamide (PubChem CID 70284419) has the molecular formula C29H41N3O5 and a molecular weight of 511.66 g/mol. Its IUPAC name is 5-[1-[2-tert-butyl-5-(methylcarbamoyl)anilino]-1-oxooctan-3-yl]-2,4-dimethoxybenzamide.
| Compound Name | 5-[1-[2-tert-butyl-5-(methylcarbamoyl)anilino]-1-oxooctan-3-yl]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 70284419 |
| Molecular Formula | C29H41N3O5 |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.30 |
| IUPAC Name | 5-[1-[2-tert-butyl-5-(methylcarbamoyl)anilino]-1-oxooctan-3-yl]-2,4-dimethoxybenzamide |
| SMILES | CCCCCC(CC(=O)Nc1cc(C(=O)NC)ccc1C(C)(C)C)c1cc(C(N)=O)c(OC)cc1OC |
| InChI | InChI=1S/C29H41N3O5/c1-8-9-10-11-18(20-16-21(27(30)34)25(37-7)17-24(20)36-6)15-26(33)32-23-14-19(28(35)31-5)12-13-22(23)29(2,3)4/h12-14,16-18H,8-11,15H2,1-7H3,(H2,30,34)(H,31,35)(H,32,33) |
| InChIKey | JGHSGARXVQBWIF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|