C31H46N2O5 — CID 70288003
4-tert-butyl-3-[3-(2,4-dimethoxyphenyl)nonanoylamino]-N-(2-methoxyethyl)benzamide (PubChem CID 70288003) has the molecular formula C31H46N2O5 and a molecular weight of 526.72 g/mol. Its IUPAC name is 4-tert-butyl-3-[3-(2,4-dimethoxyphenyl)nonanoylamino]-N-(2-methoxyethyl)benzamide.
| Compound Name | 4-tert-butyl-3-[3-(2,4-dimethoxyphenyl)nonanoylamino]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 70288003 |
| Molecular Formula | C31H46N2O5 |
| Molecular Weight | 526.72 g/mol |
| Exact Mass | 526.34 |
| IUPAC Name | 4-tert-butyl-3-[3-(2,4-dimethoxyphenyl)nonanoylamino]-N-(2-methoxyethyl)benzamide |
| SMILES | CCCCCCC(CC(=O)Nc1cc(C(=O)NCCOC)ccc1C(C)(C)C)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C31H46N2O5/c1-8-9-10-11-12-22(25-15-14-24(37-6)21-28(25)38-7)20-29(34)33-27-19-23(30(35)32-17-18-36-5)13-16-26(27)31(2,3)4/h13-16,19,21-22H,8-12,17-18,20H2,1-7H3,(H,32,35)(H,33,34) |
| InChIKey | ZHHPXTPQNGNNDN-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.72 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|