C27H40N2O3 — CID 19348478
N-[5-(aminomethyl)-2-tert-butylphenyl]-3-(2,4-dimethoxyphenyl)octanamide (PubChem CID 19348478) has the molecular formula C27H40N2O3 and a molecular weight of 440.63 g/mol. Its IUPAC name is N-[5-(aminomethyl)-2-tert-butylphenyl]-3-(2,4-dimethoxyphenyl)octanamide.
| Compound Name | N-[5-(aminomethyl)-2-tert-butylphenyl]-3-(2,4-dimethoxyphenyl)octanamide |
|---|---|
| PubChem CID | 19348478 |
| Molecular Formula | C27H40N2O3 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | N-[5-(aminomethyl)-2-tert-butylphenyl]-3-(2,4-dimethoxyphenyl)octanamide |
| SMILES | CCCCCC(CC(=O)Nc1cc(CN)ccc1C(C)(C)C)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C27H40N2O3/c1-7-8-9-10-20(22-13-12-21(31-5)17-25(22)32-6)16-26(30)29-24-15-19(18-28)11-14-23(24)27(2,3)4/h11-15,17,20H,7-10,16,18,28H2,1-6H3,(H,29,30) |
| InChIKey | PVZPDGLMRDAWTG-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|