C30H43NO4 — CID 139706236
ethyl 3-[4-tert-butyl-3-[3-(4-methoxyphenyl)octanoylamino]phenyl]propanoate (PubChem CID 139706236) has the molecular formula C30H43NO4 and a molecular weight of 481.68 g/mol. Its IUPAC name is ethyl 3-[4-tert-butyl-3-[3-(4-methoxyphenyl)octanoylamino]phenyl]propanoate.
| Compound Name | ethyl 3-[4-tert-butyl-3-[3-(4-methoxyphenyl)octanoylamino]phenyl]propanoate |
|---|---|
| PubChem CID | 139706236 |
| Molecular Formula | C30H43NO4 |
| Molecular Weight | 481.68 g/mol |
| Exact Mass | 481.32 |
| IUPAC Name | ethyl 3-[4-tert-butyl-3-[3-(4-methoxyphenyl)octanoylamino]phenyl]propanoate |
| SMILES | CCCCCC(CC(=O)Nc1cc(CCC(=O)OCC)ccc1C(C)(C)C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C30H43NO4/c1-7-9-10-11-24(23-14-16-25(34-6)17-15-23)21-28(32)31-27-20-22(13-19-29(33)35-8-2)12-18-26(27)30(3,4)5/h12,14-18,20,24H,7-11,13,19,21H2,1-6H3,(H,31,32) |
| InChIKey | LIZSMMDYMCDLOT-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.68 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|