C32H44N2O6 — CID 19348761
N-[2-tert-butyl-5-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-3-(2,4,6-trimethoxyphenyl)octanamide (PubChem CID 19348761) has the molecular formula C32H44N2O6 and a molecular weight of 552.71 g/mol. Its IUPAC name is N-[2-tert-butyl-5-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-3-(2,4,6-trimethoxyphenyl)octanamide.
| Compound Name | N-[2-tert-butyl-5-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-3-(2,4,6-trimethoxyphenyl)octanamide |
|---|---|
| PubChem CID | 19348761 |
| Molecular Formula | C32H44N2O6 |
| Molecular Weight | 552.71 g/mol |
| Exact Mass | 552.32 |
| IUPAC Name | N-[2-tert-butyl-5-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-3-(2,4,6-trimethoxyphenyl)octanamide |
| SMILES | CCCCCC(CC(=O)Nc1cc(CN2C(=O)CCC2=O)ccc1C(C)(C)C)c1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C32H44N2O6/c1-8-9-10-11-22(31-26(39-6)18-23(38-5)19-27(31)40-7)17-28(35)33-25-16-21(12-13-24(25)32(2,3)4)20-34-29(36)14-15-30(34)37/h12-13,16,18-19,22H,8-11,14-15,17,20H2,1-7H3,(H,33,35) |
| InChIKey | FGKBCIIWPBSZMV-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.71 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|