C33H43N3O4 — CID 19348650
N-[[4-tert-butyl-3-[3-(2,6-dimethoxyphenyl)octanoylamino]phenyl]methyl]pyridine-3-carboxamide (PubChem CID 19348650) has the molecular formula C33H43N3O4 and a molecular weight of 545.72 g/mol. Its IUPAC name is N-[[4-tert-butyl-3-[3-(2,6-dimethoxyphenyl)octanoylamino]phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | N-[[4-tert-butyl-3-[3-(2,6-dimethoxyphenyl)octanoylamino]phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 19348650 |
| Molecular Formula | C33H43N3O4 |
| Molecular Weight | 545.72 g/mol |
| Exact Mass | 545.33 |
| IUPAC Name | N-[[4-tert-butyl-3-[3-(2,6-dimethoxyphenyl)octanoylamino]phenyl]methyl]pyridine-3-carboxamide |
| SMILES | CCCCCC(CC(=O)Nc1cc(CNC(=O)c2cccnc2)ccc1C(C)(C)C)c1c(OC)cccc1OC |
| InChI | InChI=1S/C33H43N3O4/c1-7-8-9-12-24(31-28(39-5)14-10-15-29(31)40-6)20-30(37)36-27-19-23(16-17-26(27)33(2,3)4)21-35-32(38)25-13-11-18-34-22-25/h10-11,13-19,22,24H,7-9,12,20-21H2,1-6H3,(H,35,38)(H,36,37) |
| InChIKey | QWPPTSDYCAHPIZ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.72 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|