C27H37NO4 — CID 19348775
N-(2-tert-butyl-5-formylphenyl)-3-(2,6-dimethoxyphenyl)octanamide (PubChem CID 19348775) has the molecular formula C27H37NO4 and a molecular weight of 439.60 g/mol. Its IUPAC name is N-(2-tert-butyl-5-formylphenyl)-3-(2,6-dimethoxyphenyl)octanamide.
| Compound Name | N-(2-tert-butyl-5-formylphenyl)-3-(2,6-dimethoxyphenyl)octanamide |
|---|---|
| PubChem CID | 19348775 |
| Molecular Formula | C27H37NO4 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | N-(2-tert-butyl-5-formylphenyl)-3-(2,6-dimethoxyphenyl)octanamide |
| SMILES | CCCCCC(CC(=O)Nc1cc(C=O)ccc1C(C)(C)C)c1c(OC)cccc1OC |
| InChI | InChI=1S/C27H37NO4/c1-7-8-9-11-20(26-23(31-5)12-10-13-24(26)32-6)17-25(30)28-22-16-19(18-29)14-15-21(22)27(2,3)4/h10,12-16,18,20H,7-9,11,17H2,1-6H3,(H,28,30) |
| InChIKey | VDRUIKDNJAJMSN-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|