C28H40BrNO4 — CID 19348524
N-[5-(bromomethyl)-2-tert-butylphenyl]-3-(3,4,5-trimethoxyphenyl)octanamide (PubChem CID 19348524) has the molecular formula C28H40BrNO4 and a molecular weight of 534.54 g/mol. Its IUPAC name is N-[5-(bromomethyl)-2-tert-butylphenyl]-3-(3,4,5-trimethoxyphenyl)octanamide.
| Compound Name | N-[5-(bromomethyl)-2-tert-butylphenyl]-3-(3,4,5-trimethoxyphenyl)octanamide |
|---|---|
| PubChem CID | 19348524 |
| Molecular Formula | C28H40BrNO4 |
| Molecular Weight | 534.54 g/mol |
| Exact Mass | 533.21 |
| IUPAC Name | N-[5-(bromomethyl)-2-tert-butylphenyl]-3-(3,4,5-trimethoxyphenyl)octanamide |
| SMILES | CCCCCC(CC(=O)Nc1cc(CBr)ccc1C(C)(C)C)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C28H40BrNO4/c1-8-9-10-11-20(21-15-24(32-5)27(34-7)25(16-21)33-6)17-26(31)30-23-14-19(18-29)12-13-22(23)28(2,3)4/h12-16,20H,8-11,17-18H2,1-7H3,(H,30,31) |
| InChIKey | FDRLHQFPCQKQRZ-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.54 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|