C24H32N2O3 — CID 86237840
4-tert-butyl-3-(3-pyridin-3-yloctanoylamino)benzoic acid (PubChem CID 86237840) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is 4-tert-butyl-3-(3-pyridin-3-yloctanoylamino)benzoic acid.
| Compound Name | 4-tert-butyl-3-(3-pyridin-3-yloctanoylamino)benzoic acid |
|---|---|
| PubChem CID | 86237840 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 4-tert-butyl-3-(3-pyridin-3-yloctanoylamino)benzoic acid |
| SMILES | CCCCCC(CC(=O)Nc1cc(C(=O)O)ccc1C(C)(C)C)c1cccnc1 |
| InChI | InChI=1S/C24H32N2O3/c1-5-6-7-9-17(19-10-8-13-25-16-19)15-22(27)26-21-14-18(23(28)29)11-12-20(21)24(2,3)4/h8,10-14,16-17H,5-7,9,15H2,1-4H3,(H,26,27)(H,28,29) |
| InChIKey | UKKQSOAACZDCNY-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|