C26H36N2O4 — CID 19348764
4-tert-butyl-3-[3-(2,4-dimethoxyphenyl)heptanoylamino]benzamide (PubChem CID 19348764) has the molecular formula C26H36N2O4 and a molecular weight of 440.58 g/mol. Its IUPAC name is 4-tert-butyl-3-[3-(2,4-dimethoxyphenyl)heptanoylamino]benzamide.
| Compound Name | 4-tert-butyl-3-[3-(2,4-dimethoxyphenyl)heptanoylamino]benzamide |
|---|---|
| PubChem CID | 19348764 |
| Molecular Formula | C26H36N2O4 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | 4-tert-butyl-3-[3-(2,4-dimethoxyphenyl)heptanoylamino]benzamide |
| SMILES | CCCCC(CC(=O)Nc1cc(C(N)=O)ccc1C(C)(C)C)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C26H36N2O4/c1-7-8-9-17(20-12-11-19(31-5)16-23(20)32-6)15-24(29)28-22-14-18(25(27)30)10-13-21(22)26(2,3)4/h10-14,16-17H,7-9,15H2,1-6H3,(H2,27,30)(H,28,29) |
| InChIKey | AHNZLOJEQYUNBB-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |