C24H33ClN2O5S — CID 139784447
N-(2-tert-butyl-5-sulfamoylphenyl)-3-(5-chloro-2,4-dimethoxyphenyl)hexanamide (PubChem CID 139784447) has the molecular formula C24H33ClN2O5S and a molecular weight of 497.06 g/mol. Its IUPAC name is N-(2-tert-butyl-5-sulfamoylphenyl)-3-(5-chloro-2,4-dimethoxyphenyl)hexanamide.
| Compound Name | N-(2-tert-butyl-5-sulfamoylphenyl)-3-(5-chloro-2,4-dimethoxyphenyl)hexanamide |
|---|---|
| PubChem CID | 139784447 |
| Molecular Formula | C24H33ClN2O5S |
| Molecular Weight | 497.06 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | N-(2-tert-butyl-5-sulfamoylphenyl)-3-(5-chloro-2,4-dimethoxyphenyl)hexanamide |
| SMILES | CCCC(CC(=O)Nc1cc(S(N)(=O)=O)ccc1C(C)(C)C)c1cc(Cl)c(OC)cc1OC |
| InChI | InChI=1S/C24H33ClN2O5S/c1-7-8-15(17-13-19(25)22(32-6)14-21(17)31-5)11-23(28)27-20-12-16(33(26,29)30)9-10-18(20)24(2,3)4/h9-10,12-15H,7-8,11H2,1-6H3,(H,27,28)(H2,26,29,30) |
| InChIKey | ULPUKDPCOCNKGI-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.06 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |