C11H16ClN3O3S — CID 107568676
(2S)-2-amino-N-(2-chloro-5-sulfamoylphenyl)pentanamide (PubChem CID 107568676) has the molecular formula C11H16ClN3O3S and a molecular weight of 305.79 g/mol. Its IUPAC name is (2S)-2-amino-N-(2-chloro-5-sulfamoylphenyl)pentanamide.
| Compound Name | (2S)-2-amino-N-(2-chloro-5-sulfamoylphenyl)pentanamide |
|---|---|
| PubChem CID | 107568676 |
| Molecular Formula | C11H16ClN3O3S |
| Molecular Weight | 305.79 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | (2S)-2-amino-N-(2-chloro-5-sulfamoylphenyl)pentanamide |
| SMILES | CCC[C@H](N)C(=O)Nc1cc(S(N)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C11H16ClN3O3S/c1-2-3-9(13)11(16)15-10-6-7(19(14,17)18)4-5-8(10)12/h4-6,9H,2-3,13H2,1H3,(H,15,16)(H2,14,17,18)/t9-/m0/s1 |
| InChIKey | LQHBCGTWEWRBCG-VIFPVBQESA-N |
| XLogP | 1.05 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.79 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |