C29H40ClNO6 — CID 139784288
methyl 4-tert-butyl-3-[[3-[5-chloro-2-methoxy-4-(2-methoxyethoxy)phenyl]-5-methylhexanoyl]amino]benzoate (PubChem CID 139784288) has the molecular formula C29H40ClNO6 and a molecular weight of 534.09 g/mol. Its IUPAC name is methyl 4-tert-butyl-3-[[3-[5-chloro-2-methoxy-4-(2-methoxyethoxy)phenyl]-5-methylhexanoyl]amino]benzoate.
| Compound Name | methyl 4-tert-butyl-3-[[3-[5-chloro-2-methoxy-4-(2-methoxyethoxy)phenyl]-5-methylhexanoyl]amino]benzoate |
|---|---|
| PubChem CID | 139784288 |
| Molecular Formula | C29H40ClNO6 |
| Molecular Weight | 534.09 g/mol |
| Exact Mass | 533.25 |
| IUPAC Name | methyl 4-tert-butyl-3-[[3-[5-chloro-2-methoxy-4-(2-methoxyethoxy)phenyl]-5-methylhexanoyl]amino]benzoate |
| SMILES | COCCOc1cc(OC)c(C(CC(=O)Nc2cc(C(=O)OC)ccc2C(C)(C)C)CC(C)C)cc1Cl |
| InChI | InChI=1S/C29H40ClNO6/c1-18(2)13-20(21-16-23(30)26(17-25(21)35-7)37-12-11-34-6)15-27(32)31-24-14-19(28(33)36-8)9-10-22(24)29(3,4)5/h9-10,14,16-18,20H,11-13,15H2,1-8H3,(H,31,32) |
| InChIKey | GYPKBPMHOYIIQB-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.09 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|