C13H16ClNO5 — CID 103606710
methyl 4-chloro-3-[[2-(2-methoxyethoxy)acetyl]amino]benzoate (PubChem CID 103606710) has the molecular formula C13H16ClNO5 and a molecular weight of 301.73 g/mol. Its IUPAC name is methyl 4-chloro-3-[[2-(2-methoxyethoxy)acetyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[2-(2-methoxyethoxy)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 103606710 |
| Molecular Formula | C13H16ClNO5 |
| Molecular Weight | 301.73 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | methyl 4-chloro-3-[[2-(2-methoxyethoxy)acetyl]amino]benzoate |
| SMILES | COCCOCC(=O)Nc1cc(C(=O)OC)ccc1Cl |
| InChI | InChI=1S/C13H16ClNO5/c1-18-5-6-20-8-12(16)15-11-7-9(13(17)19-2)3-4-10(11)14/h3-4,7H,5-6,8H2,1-2H3,(H,15,16) |
| InChIKey | RSOPAPLVZDZCNN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.73 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|