C32H45NO5 — CID 139684209
3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-[3-(1,3-dioxan-2-yl)propyl]phenyl]octanamide (PubChem CID 139684209) has the molecular formula C32H45NO5 and a molecular weight of 523.71 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-[3-(1,3-dioxan-2-yl)propyl]phenyl]octanamide.
| Compound Name | 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-[3-(1,3-dioxan-2-yl)propyl]phenyl]octanamide |
|---|---|
| PubChem CID | 139684209 |
| Molecular Formula | C32H45NO5 |
| Molecular Weight | 523.71 g/mol |
| Exact Mass | 523.33 |
| IUPAC Name | 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-[3-(1,3-dioxan-2-yl)propyl]phenyl]octanamide |
| SMILES | CCCCCC(CC(=O)Nc1cc(CCCC2OCCCO2)ccc1C(C)(C)C)c1cccc2c1OCO2 |
| InChI | InChI=1S/C32H45NO5/c1-5-6-7-12-24(25-13-9-14-28-31(25)38-22-37-28)21-29(34)33-27-20-23(16-17-26(27)32(2,3)4)11-8-15-30-35-18-10-19-36-30/h9,13-14,16-17,20,24,30H,5-8,10-12,15,18-19,21-22H2,1-4H3,(H,33,34) |
| InChIKey | QPFJNTQGUORSFD-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.71 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|