C15H22ClNO3 — CID 139684216
2-(1,3-benzodioxol-4-yl)octanamide;hydrochloride (PubChem CID 139684216) has the molecular formula C15H22ClNO3 and a molecular weight of 299.80 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-4-yl)octanamide;hydrochloride.
| Compound Name | 2-(1,3-benzodioxol-4-yl)octanamide;hydrochloride |
|---|---|
| PubChem CID | 139684216 |
| Molecular Formula | C15H22ClNO3 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-(1,3-benzodioxol-4-yl)octanamide;hydrochloride |
| SMILES | CCCCCCC(C(N)=O)c1cccc2c1OCO2.Cl |
| InChI | InChI=1S/C15H21NO3.ClH/c1-2-3-4-5-7-12(15(16)17)11-8-6-9-13-14(11)19-10-18-13;/h6,8-9,12H,2-5,7,10H2,1H3,(H2,16,17);1H |
| InChIKey | HUHWGIFEKFQTIQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|