C10H14ClNO2 — CID 171205176
(1R)-1-(1,3-benzodioxol-4-yl)propan-1-amine;hydrochloride (PubChem CID 171205176) has the molecular formula C10H14ClNO2 and a molecular weight of 215.68 g/mol. Its IUPAC name is (1R)-1-(1,3-benzodioxol-4-yl)propan-1-amine;hydrochloride.
| Compound Name | (1R)-1-(1,3-benzodioxol-4-yl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171205176 |
| Molecular Formula | C10H14ClNO2 |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | (1R)-1-(1,3-benzodioxol-4-yl)propan-1-amine;hydrochloride |
| SMILES | CC[C@@H](N)c1cccc2c1OCO2.Cl |
| InChI | InChI=1S/C10H13NO2.ClH/c1-2-8(11)7-4-3-5-9-10(7)13-6-12-9;/h3-5,8H,2,6,11H2,1H3;1H/t8-;/m1./s1 |
| InChIKey | YTPMDKPMXIMZQT-DDWIOCJRSA-N |
| XLogP | 2.25 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |