C9H9F2NO2 — CID 130692389
(1R)-1-(1,3-benzodioxol-4-yl)-2,2-difluoroethanamine (PubChem CID 130692389) has the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. Its IUPAC name is (1R)-1-(1,3-benzodioxol-4-yl)-2,2-difluoroethanamine.
| Compound Name | (1R)-1-(1,3-benzodioxol-4-yl)-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 130692389 |
| Molecular Formula | C9H9F2NO2 |
| Molecular Weight | 201.17 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | (1R)-1-(1,3-benzodioxol-4-yl)-2,2-difluoroethanamine |
| SMILES | N[C@H](c1cccc2c1OCO2)C(F)F |
| InChI | InChI=1S/C9H9F2NO2/c10-9(11)7(12)5-2-1-3-6-8(5)14-4-13-6/h1-3,7,9H,4,12H2/t7-/m1/s1 |
| InChIKey | NPVYPFKAXLRQPW-SSDOTTSWSA-N |
| XLogP | 1.68 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.17 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |