C9H8N2O2 — CID 130857097
(2S)-2-amino-2-(1,3-benzodioxol-4-yl)acetonitrile (PubChem CID 130857097) has the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. Its IUPAC name is (2S)-2-amino-2-(1,3-benzodioxol-4-yl)acetonitrile.
| Compound Name | (2S)-2-amino-2-(1,3-benzodioxol-4-yl)acetonitrile |
|---|---|
| PubChem CID | 130857097 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | (2S)-2-amino-2-(1,3-benzodioxol-4-yl)acetonitrile |
| SMILES | N#C[C@@H](N)c1cccc2c1OCO2 |
| InChI | InChI=1S/C9H8N2O2/c10-4-7(11)6-2-1-3-8-9(6)13-5-12-8/h1-3,7H,5,11H2/t7-/m1/s1 |
| InChIKey | AWZVHUBBXRQJJO-SSDOTTSWSA-N |
| XLogP | 0.94 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |