C10H15ClN2O2 — CID 171224743
(1S)-1-(1,3-benzodioxol-4-yl)propane-1,3-diamine;hydrochloride (PubChem CID 171224743) has the molecular formula C10H15ClN2O2 and a molecular weight of 230.69 g/mol. Its IUPAC name is (1S)-1-(1,3-benzodioxol-4-yl)propane-1,3-diamine;hydrochloride.
| Compound Name | (1S)-1-(1,3-benzodioxol-4-yl)propane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 171224743 |
| Molecular Formula | C10H15ClN2O2 |
| Molecular Weight | 230.69 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | (1S)-1-(1,3-benzodioxol-4-yl)propane-1,3-diamine;hydrochloride |
| SMILES | Cl.NCC[C@H](N)c1cccc2c1OCO2 |
| InChI | InChI=1S/C10H14N2O2.ClH/c11-5-4-8(12)7-2-1-3-9-10(7)14-6-13-9;/h1-3,8H,4-6,11-12H2;1H/t8-;/m0./s1 |
| InChIKey | JWUBGUDXNIFCRS-QRPNPIFTSA-N |
| XLogP | 1.19 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.69 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |