C10H13NO2 — CID 55283444
1-(1,3-benzodioxol-4-yl)propan-1-amine (PubChem CID 55283444) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-4-yl)propan-1-amine.
| Compound Name | 1-(1,3-benzodioxol-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 55283444 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 1-(1,3-benzodioxol-4-yl)propan-1-amine |
| SMILES | CCC(N)c1cccc2c1OCO2 |
| InChI | InChI=1S/C10H13NO2/c1-2-8(11)7-4-3-5-9-10(7)13-6-12-9/h3-5,8H,2,6,11H2,1H3 |
| InChIKey | JFZOMWQWYOPVTP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |