C9H11NO3 — CID 55277961
(2S)-2-amino-2-(1,3-benzodioxol-4-yl)ethanol (PubChem CID 55277961) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is (2S)-2-amino-2-(1,3-benzodioxol-4-yl)ethanol.
| Compound Name | (2S)-2-amino-2-(1,3-benzodioxol-4-yl)ethanol |
|---|---|
| PubChem CID | 55277961 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | (2S)-2-amino-2-(1,3-benzodioxol-4-yl)ethanol |
| SMILES | N[C@H](CO)c1cccc2c1OCO2 |
| InChI | InChI=1S/C9H11NO3/c10-7(4-11)6-2-1-3-8-9(6)13-5-12-8/h1-3,7,11H,4-5,10H2/t7-/m1/s1 |
| InChIKey | FRLXMLLXGIGOCR-SSDOTTSWSA-N |
| XLogP | 0.41 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |