C12H17NO3 — CID 131279088
(3R)-3-amino-3-(1,3-benzodioxol-4-yl)-2,2-dimethylpropan-1-ol (PubChem CID 131279088) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is (3R)-3-amino-3-(1,3-benzodioxol-4-yl)-2,2-dimethylpropan-1-ol.
| Compound Name | (3R)-3-amino-3-(1,3-benzodioxol-4-yl)-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 131279088 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | (3R)-3-amino-3-(1,3-benzodioxol-4-yl)-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(CO)[C@@H](N)c1cccc2c1OCO2 |
| InChI | InChI=1S/C12H17NO3/c1-12(2,6-14)11(13)8-4-3-5-9-10(8)16-7-15-9/h3-5,11,14H,6-7,13H2,1-2H3/t11-/m0/s1 |
| InChIKey | GLDWFWWMBSWJKN-NSHDSACASA-N |
| XLogP | 1.43 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |