C11H15NO3 — CID 167758357
2-[1-(1,3-benzodioxol-4-yl)ethylamino]ethanol (PubChem CID 167758357) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 2-[1-(1,3-benzodioxol-4-yl)ethylamino]ethanol.
| Compound Name | 2-[1-(1,3-benzodioxol-4-yl)ethylamino]ethanol |
|---|---|
| PubChem CID | 167758357 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 2-[1-(1,3-benzodioxol-4-yl)ethylamino]ethanol |
| SMILES | CC(NCCO)c1cccc2c1OCO2 |
| InChI | InChI=1S/C11H15NO3/c1-8(12-5-6-13)9-3-2-4-10-11(9)15-7-14-10/h2-4,8,12-13H,5-7H2,1H3 |
| InChIKey | JUCKYRPAHVOZGX-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |