C16H16ClNO2 — CID 43583627
N-(1,3-benzodioxol-4-ylmethyl)-1-(2-chlorophenyl)ethanamine (PubChem CID 43583627) has the molecular formula C16H16ClNO2 and a molecular weight of 289.76 g/mol. Its IUPAC name is N-(1,3-benzodioxol-4-ylmethyl)-1-(2-chlorophenyl)ethanamine.
| Compound Name | N-(1,3-benzodioxol-4-ylmethyl)-1-(2-chlorophenyl)ethanamine |
|---|---|
| PubChem CID | 43583627 |
| Molecular Formula | C16H16ClNO2 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-(1,3-benzodioxol-4-ylmethyl)-1-(2-chlorophenyl)ethanamine |
| SMILES | CC(NCc1cccc2c1OCO2)c1ccccc1Cl |
| InChI | InChI=1S/C16H16ClNO2/c1-11(13-6-2-3-7-14(13)17)18-9-12-5-4-8-15-16(12)20-10-19-15/h2-8,11,18H,9-10H2,1H3 |
| InChIKey | TXZZTDHYZMLZDU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |