C16H16FNO2 — CID 81364742
(1S)-N-(1,3-benzodioxol-4-ylmethyl)-1-(3-fluorophenyl)ethanamine (PubChem CID 81364742) has the molecular formula C16H16FNO2 and a molecular weight of 273.31 g/mol. Its IUPAC name is (1S)-N-(1,3-benzodioxol-4-ylmethyl)-1-(3-fluorophenyl)ethanamine.
| Compound Name | (1S)-N-(1,3-benzodioxol-4-ylmethyl)-1-(3-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 81364742 |
| Molecular Formula | C16H16FNO2 |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | (1S)-N-(1,3-benzodioxol-4-ylmethyl)-1-(3-fluorophenyl)ethanamine |
| SMILES | C[C@H](NCc1cccc2c1OCO2)c1cccc(F)c1 |
| InChI | InChI=1S/C16H16FNO2/c1-11(12-4-2-6-14(17)8-12)18-9-13-5-3-7-15-16(13)20-10-19-15/h2-8,11,18H,9-10H2,1H3/t11-/m0/s1 |
| InChIKey | ZDLLVBRIRDHWGZ-NSHDSACASA-N |
| XLogP | 3.41 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |