C17H18FNO2 — CID 114871455
N-(1,3-benzodioxol-4-ylmethyl)-1-(3-fluorophenyl)propan-1-amine (PubChem CID 114871455) has the molecular formula C17H18FNO2 and a molecular weight of 287.33 g/mol. Its IUPAC name is N-(1,3-benzodioxol-4-ylmethyl)-1-(3-fluorophenyl)propan-1-amine.
| Compound Name | N-(1,3-benzodioxol-4-ylmethyl)-1-(3-fluorophenyl)propan-1-amine |
|---|---|
| PubChem CID | 114871455 |
| Molecular Formula | C17H18FNO2 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | N-(1,3-benzodioxol-4-ylmethyl)-1-(3-fluorophenyl)propan-1-amine |
| SMILES | CCC(NCc1cccc2c1OCO2)c1cccc(F)c1 |
| InChI | InChI=1S/C17H18FNO2/c1-2-15(12-5-3-7-14(18)9-12)19-10-13-6-4-8-16-17(13)21-11-20-16/h3-9,15,19H,2,10-11H2,1H3 |
| InChIKey | SLKQYDOWPJURFF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |